From 25724093067e729f1b43e0df823fe9e8c3f1ea97 Mon Sep 17 00:00:00 2001 From: Michael Kelley Date: Mon, 21 Dec 2015 06:09:45 -0500 Subject: [PATCH 1/3] add xAxisRotateLabels option add option to rotate x-axis labels by n degrees. --- src/angular-charts.js | 1664 ++++++++++++++++++----------------------- 1 file changed, 708 insertions(+), 956 deletions(-) diff --git a/src/angular-charts.js b/src/angular-charts.js index d4741a0..34d97e2 100644 --- a/src/angular-charts.js +++ b/src/angular-charts.js @@ -2,52 +2,55 @@ * Main module */ angular.module('angularCharts', ['angularChartsTemplates']); - /** * Main directive handling drawing of all charts */ -angular.module('angularCharts').directive('acChart', function($templateCache, $compile, $rootElement, $window, $timeout, $sce) { - - var defaultColors = [ - 'rgb(255,153,0)', - 'rgb(220,57,18)', - 'rgb(70,132,238)', - 'rgb(73,66,204)', - 'rgb(0,128,0)', - 'rgb(0, 169, 221)', - 'steelBlue', - 'rgb(0, 169, 221)', - 'rgb(50, 205, 252)', - 'rgb(70,132,238)', - 'rgb(0, 169, 221)', - 'rgb(5, 150, 194)', - 'rgb(50, 183, 224)', - 'steelBlue', - 'rgb(2, 185, 241)', - 'rgb(0, 169, 221)', - 'steelBlue', - 'rgb(0, 169, 221)', - 'rgb(50, 205, 252)', - 'rgb(70,132,238)', - 'rgb(0, 169, 221)', - 'rgb(5, 150, 194)', - 'rgb(50, 183, 224)', - 'steelBlue', - 'rgb(2, 185, 241)' - ]; - - /** +angular.module('angularCharts').directive('acChart', [ + '$templateCache', + '$compile', + '$rootElement', + '$window', + '$timeout', + '$sce', + function ($templateCache, $compile, $rootElement, $window, $timeout, $sce) { + var defaultColors = [ + 'rgb(255,153,0)', + 'rgb(220,57,18)', + 'rgb(70,132,238)', + 'rgb(73,66,204)', + 'rgb(0,128,0)', + 'rgb(0, 169, 221)', + 'steelBlue', + 'rgb(0, 169, 221)', + 'rgb(50, 205, 252)', + 'rgb(70,132,238)', + 'rgb(0, 169, 221)', + 'rgb(5, 150, 194)', + 'rgb(50, 183, 224)', + 'steelBlue', + 'rgb(2, 185, 241)', + 'rgb(0, 169, 221)', + 'steelBlue', + 'rgb(0, 169, 221)', + 'rgb(50, 205, 252)', + 'rgb(70,132,238)', + 'rgb(0, 169, 221)', + 'rgb(5, 150, 194)', + 'rgb(50, 183, 224)', + 'steelBlue', + 'rgb(2, 185, 241)' + ]; + /** * Utility function to call when we run out of colors! * @return {String} Hexadecimal color */ - function getRandomColor() { - var r = (Math.round(Math.random() * 127) + 127).toString(16); - var g = (Math.round(Math.random() * 127) + 127).toString(16); - var b = (Math.round(Math.random() * 127) + 127).toString(16); - return '#' + r + g + b; - } - - /** + function getRandomColor() { + var r = (Math.round(Math.random() * 127) + 127).toString(16); + var g = (Math.round(Math.random() * 127) + 127).toString(16); + var b = (Math.round(Math.random() * 127) + 127).toString(16); + return '#' + r + g + b; + } + /** * Utility function that gets the child that matches the classname * because Angular.element.children() doesn't take selectors * it's still better than a whole jQuery implementation @@ -55,67 +58,59 @@ angular.module('angularCharts').directive('acChart', function($templateCache, $c * @param {String} className Class name * @return {Angular.element|null} The founded child or null */ - function getChildrenByClassname(childrens, className) { - var child = null; - - for (var i = 0; i < childrens.length; i++) { - if (angular.isElement(childrens[i])) { - child = angular.element(childrens[i]); - if (child.hasClass(className)) - return child; + function getChildrenByClassname(childrens, className) { + var child = null; + for (var i = 0; i < childrens.length; i++) { + if (angular.isElement(childrens[i])) { + child = angular.element(childrens[i]); + if (child.hasClass(className)) + return child; + } } + return child; } - - return child; - } - - /** + /** * Main link function * @param {[type]} scope [description] * @param {[type]} element [description] * @param {[type]} attrs [description] * @return {[type]} [description] */ - function link(scope, element, attrs) { - - var config = { - title: '', - tooltips: true, - labels: false, - mouseover: function() {}, - mouseout: function() {}, - click: function() {}, - legend: { - display: true, // can be either 'left' or 'right'. - position: 'left', - htmlEnabled: false - }, - colors: defaultColors, - innerRadius: 0, // Only on pie Charts - lineLegend: 'lineEnd', // Only on line Charts - lineCurveType: 'cardinal', - isAnimate: true, - yAxisTickFormat: 's', - waitForHeightAndWidth: false - }; - - prepareConfig(); - - var totalWidth = element[0].clientWidth; - var totalHeight = element[0].clientHeight; - - validateHeightAndWidth(); - - var data, - series, - points, - height, - width, - chartContainer, - legendContainer, - chartType; - - /** + function link(scope, element, attrs) { + var config = { + title: '', + tooltips: true, + labels: false, + mouseover: function () { + }, + mouseout: function () { + }, + click: function () { + }, + legend: { + display: true, + position: 'left', + htmlEnabled: false + }, + colors: defaultColors, + innerRadius: 0, + lineLegend: 'lineEnd', + lineCurveType: 'cardinal', + isAnimate: true, + yAxisTickFormat: 's', + waitForHeightAndWidth: false, + xAxisRotateLabels: { + rotate: false, // boolean, default to false. true rotates x-axis labels by n degrees + degrees: 0,// number of degrees to rotate x-axis label + extendBottom: 0 // number of px, if any to extend bottom margin to accomodate rotated labels + } + }; + prepareConfig(); + var totalWidth = element[0].clientWidth; + var totalHeight = element[0].clientHeight; + validateHeightAndWidth(); + var data, series, points, height, width, chartContainer, legendContainer, chartType; + /** * All the magic happens here * handles extracting chart type * getting data @@ -123,43 +118,42 @@ angular.module('angularCharts').directive('acChart', function($templateCache, $c * drawing the chart * @return {[type]} [description] */ - function init() { - if (!validateHeightAndWidth()) { + function init() { + if (!validateHeightAndWidth()) { return; + } + prepareConfig(); + prepareData(); + setHeightWidth(); + setContainers(); + var chartFunc = getChartFunction(chartType); + chartFunc(); + drawLegend(); } - prepareData(); - setHeightWidth(); - setContainers(); - var chartFunc = getChartFunction(chartType); - chartFunc(); - drawLegend(); - } - - /** + /** * Checks that the height and width are valid. * It throws an exception unless the config key waitForHeightAndWidth is set to true */ - function validateHeightAndWidth() { - if (totalHeight && totalWidth) { - return true; - } - if (config.waitForHeightAndWidth) { - return false; + function validateHeightAndWidth() { + if (totalHeight && totalWidth) { + return true; + } + if (config.waitForHeightAndWidth) { + return false; + } + throw new Error('Please set height and width for the chart element'); } - throw new Error('Please set height and width for the chart element'); - } - - /** + /** * Sets height and width of chart area based on legend * used for setting radius, bar width of chart */ - function setHeightWidth() { - if (!config.legend.display) { - height = totalHeight; - width = totalWidth; - return; - } - switch (config.legend.position) { + function setHeightWidth() { + if (!config.legend.display) { + height = totalHeight; + width = totalWidth; + return; + } + switch (config.legend.position) { case 'top': case 'bottom': height = totalHeight * 0.75; @@ -170,1041 +164,799 @@ angular.module('angularCharts').directive('acChart', function($templateCache, $c height = totalHeight; width = totalWidth * 0.75; break; + } } - } - - /** + /** * Creates appropriate DOM structure for legend + chart */ - function setContainers() { - var container = $templateCache.get('angularChartsTemplate_' + config.legend.position); - element.html(container); //http://stackoverflow.com/a/17883151 - $compile(element.contents())(scope); - - //getting children divs - var childrens = element.find('div'); - chartContainer = getChildrenByClassname(childrens, 'ac-chart'); - legendContainer = getChildrenByClassname(childrens, 'ac-legend'); - - height -= getChildrenByClassname(childrens, 'ac-title')[0].clientHeight; - } - - /** + function setContainers() { + var container = $templateCache.get('angularChartsTemplate_' + config.legend.position); + element.html(container); + //http://stackoverflow.com/a/17883151 + $compile(element.contents())(scope); + //getting children divs + var childrens = element.find('div'); + chartContainer = getChildrenByClassname(childrens, 'ac-chart'); + legendContainer = getChildrenByClassname(childrens, 'ac-legend'); + height -= getChildrenByClassname(childrens, 'ac-title')[0].clientHeight; + } + /** * Merges the give configuration with the default configuration */ - function prepareConfig() { - if (scope.acConfig) { - angular.extend(config, scope.acConfig); + function prepareConfig() { + if (scope.acConfig) { + angular.extend(config, scope.acConfig); + } } - } - - /** + /** * Parses data from attributes * @return {[type]} [description] */ - function prepareData() { - data = scope.acData; - chartType = scope.acChart; - series = (data) ? data.series || [] : []; - points = (data) ? data.data || [] : []; - } - - /** + function prepareData() { + data = scope.acData; + chartType = scope.acChart; + series = data ? data.series || [] : []; + points = data ? data.data || [] : []; + } + /** * Returns appropriate chart function to call * @param {[type]} type [description] * @return {[type]} [description] */ - function getChartFunction(type) { - var charts = { - 'pie': pieChart, - 'bar': barChart, - 'line': lineChart, - 'area': areaChart, - 'point': pointChart, - }; - return charts[type]; - } - - /** + function getChartFunction(type) { + var charts = { + 'pie': pieChart, + 'bar': barChart, + 'line': lineChart, + 'area': areaChart, + 'point': pointChart + }; + return charts[type]; + } + /** * Filters down the x axis labels if a limit is specified */ - function filterXAxis(xAxis, x) { - var allTicks = x.domain(); - if (config.xAxisMaxTicks && allTicks.length > config.xAxisMaxTicks) { - var mod = Math.ceil(allTicks.length / config.xAxisMaxTicks); - xAxis.tickValues(allTicks.filter(function(e, i) { - return (i % mod) === 0; - })); + function filterXAxis(xAxis, x) { + var allTicks = x.domain(); + if (config.xAxisMaxTicks && allTicks.length > config.xAxisMaxTicks) { + var mod = Math.ceil(allTicks.length / config.xAxisMaxTicks); + xAxis.tickValues(allTicks.filter(function (e, i) { + return i % mod === 0; + })); + } } - } - - /** + /** * Draws a bar chart, grouped with negative value handling * @return {[type]} [description] */ - function barChart() { - /** + function barChart() { + /** * Setup date attributes * @type {Object} */ - var margin = { - top: 0, - right: 20, - bottom: 30, - left: 40 - }; - width -= margin.left + margin.right; - height -= margin.top + margin.bottom; - - var x = d3.scale.ordinal() - .rangeRoundBands([0, width], 0.1); - - var y = d3.scale.linear() - .range([height, 10]); - - var x0 = d3.scale.ordinal() - .rangeRoundBands([0, width], 0.1); - - var yData = [0]; - - points.forEach(function(d) { - d.nicedata = d.y.map(function(e, i) { - yData.push(e); - return { - x: d.x, - y: e, - s: i, - tooltip: angular.isArray(d.tooltip) ? d.tooltip[i] : d.tooltip + var margin = { + top: 0, + right: 20, + bottom: 30 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + left: 40 }; + width -= margin.left + margin.right; + height -= margin.top + margin.bottom; + var x = d3.scale.ordinal().rangeRoundBands([ + 0, + width + ], 0.1); + var y = d3.scale.linear().range([ + height, + 10 + ]); + var x0 = d3.scale.ordinal().rangeRoundBands([ + 0, + width + ], 0.1); + var yData = [0]; + points.forEach(function (d) { + d.nicedata = d.y.map(function (e, i) { + yData.push(e); + return { + x: d.x, + y: e, + s: i, + tooltip: angular.isArray(d.tooltip) ? d.tooltip[i] : d.tooltip + }; + }); }); - }); - - var yMaxPoints = d3.max(points.map(function(d) { - return d.y.length; - })); - - scope.yMaxData = yMaxPoints; - - x.domain(points.map(function(d) { - return d.x; - })); - var padding = d3.max(yData) * 0.20; - - y.domain([d3.min(yData), d3.max(yData) + padding]); - - x0.domain(d3.range(yMaxPoints)).rangeRoundBands([0, x.rangeBand()]); - - /** + var yMaxPoints = d3.max(points.map(function (d) { + return d.y.length; + })); + scope.yMaxData = yMaxPoints; + x.domain(points.map(function (d) { + return d.x; + })); + var padding = d3.max(yData) * 0.2; + y.domain([ + d3.min(yData), + d3.max(yData) + padding + ]); + x0.domain(d3.range(yMaxPoints)).rangeRoundBands([ + 0, + x.rangeBand() + ]); + /** * Create scales using d3 * @type {[type]} */ - var xAxis = d3.svg.axis() - .scale(x) - .orient("bottom"); - filterXAxis(xAxis, x); - - var yAxis = d3.svg.axis() - .scale(y) - .orient("left") - .ticks(10) - .tickFormat(d3.format(config.yAxisTickFormat)); - - /** + var xAxis = d3.svg.axis().scale(x).orient('bottom'); + filterXAxis(xAxis, x); + var yAxis = d3.svg.axis().scale(y).orient('left').ticks(10).tickFormat(d3.format(config.yAxisTickFormat)); + /** * Start drawing the chart! * @type {[type]} */ - var svg = d3.select(chartContainer[0]).append("svg") - .attr("width", width + margin.left + margin.right) - .attr("height", height + margin.top + margin.bottom) - .append("g") - .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); - - svg.append("g") - .attr("class", "x axis") - .attr("transform", "translate(0," + height + ")") - .call(xAxis); - - svg.append("g") - .attr("class", "y axis") - .call(yAxis); - - /** + var svg = d3.select(chartContainer[0]).append('svg').attr('width', width + margin.left + margin.right).attr('height', height + margin.top + margin.bottom).append('g').attr('transform', 'translate(' + margin.left + ',' + margin.top + ')'); + if (config.xAxisRotateLabels.rotate) { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); + } else { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); + } + svg.append('g').attr('class', 'y axis').call(yAxis); + /** * Add bars * @type {[type]} */ - var barGroups = svg.selectAll(".state") - .data(points) - .enter().append("g") - .attr("class", "g") - .attr("transform", function(d) { - return "translate(" + x(d.x) + ",0)"; - }); - - var bars = barGroups.selectAll("rect") - .data(function(d) { - return d.nicedata; - }) - .enter().append("rect"); - - bars.attr("width", x0.rangeBand()); - - bars.attr("x", function(d, i) { - return x0(i); - }) - .attr("y", height) - .style("fill", function(d) { + var barGroups = svg.selectAll('.state').data(points).enter().append('g').attr('class', 'g').attr('transform', function (d) { + return 'translate(' + x(d.x) + ',0)'; + }); + var bars = barGroups.selectAll('rect').data(function (d) { + return d.nicedata; + }).enter().append('rect'); + bars.attr('width', x0.rangeBand()); + bars.attr('x', function (d, i) { + return x0(i); + }).attr('y', height).style('fill', function (d) { return getColor(d.s); - }) - .attr("height", 0) - .transition() - .ease("cubic-in-out") - .duration(config.isAnimate ? 1000 : 0) - .attr("y", function(d) { + }).attr('height', 0).transition().ease('cubic-in-out').duration(config.isAnimate ? 1000 : 0).attr('y', function (d) { return y(Math.max(0, d.y)); - }) - .attr("height", function(d) { + }).attr('height', function (d) { return Math.abs(y(d.y) - y(0)); }); - /** + /** * Add events for tooltip * @param {[type]} d [description] * @return {[type]} [description] */ - bars.on("mouseover", function(d) { - - makeToolTip({ - index: d.x, - value: d.tooltip ? d.tooltip : d.y, - series: series[d.s] - }, d3.event); - - config.mouseover(d, d3.event); - scope.$apply(); - }) - .on("mouseleave", function(d) { + bars.on('mouseover', function (d) { + makeToolTip({ + index: d.x, + value: d.tooltip ? d.tooltip : d.y, + series: series[d.s] + }, d3.event); + config.mouseover(d, d3.event); + scope.$apply(); + }).on('mouseleave', function (d) { removeToolTip(); config.mouseout(d, d3.event); scope.$apply(); - }) - .on("mousemove", function(d) { + }).on('mousemove', function (d) { updateToolTip(d, d3.event); - }) - .on("click", function(d) { + }).on('click', function (d) { config.click.call(d, d3.event); scope.$apply(); }); - - /** + /** * Create labels */ - if (config.labels) { - barGroups.selectAll('not-a-class') - .data(function(d) { + if (config.labels) { + barGroups.selectAll('not-a-class').data(function (d) { return d.nicedata; - }) - .enter().append("text") - .attr("x", function(d, i) { + }).enter().append('text').attr('x', function (d, i) { return x0(i); - }) - .attr("y", function(d) { + }).attr('y', function (d) { return height - Math.abs(y(d.y) - y(0)); - }) - // .attr("transform", "rotate(270)") - .text(function(d) { - return d.y; - }); - } - - /** + }).text(function (d) { + return d.y; + }); + } + /** * Draw one zero line in case negative values exist */ - svg.append("line") - .attr("x1", width) - .attr("y1", y(0)) - .attr("y2", y(0)) - .style("stroke", "silver"); - } - - /** + svg.append('line').attr('x1', width).attr('y1', y(0)).attr('y2', y(0)).style('stroke', 'silver'); + } + /** * Draws a line chart * @return {[type]} [description] */ - function lineChart() { - var margin = { - top: 0, - right: 40, - bottom: 20, - left: 40 - }; - width -= margin.left + margin.right; - height -= margin.top + margin.bottom; - - var x = d3.scale.ordinal() - .domain(points.map(function(d) { - return d.x; - })) - .rangeRoundBands([0, width]); - - var y = d3.scale.linear() - .range([height, 10]); - - var xAxis = d3.svg.axis() - .scale(x) - .orient("bottom"); - filterXAxis(xAxis, x); - - var yAxis = d3.svg.axis() - .scale(y) - .orient("left") - .ticks(5) - .tickFormat(d3.format(config.yAxisTickFormat)); - - var line = d3.svg.line() - .interpolate(config.lineCurveType) - .x(function(d) { - return getX(d.x); - }) - .y(function(d) { - return y(d.y); - }); - - var yData = [0]; - var linedata = []; - - points.forEach(function(d) { - d.y.map(function(e) { - yData.push(e); + function lineChart() { + var margin = { + top: 0, + right: 40, + bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + left: 40 + }; + width -= margin.left + margin.right; + height -= margin.top + margin.bottom; + var x = d3.scale.ordinal().domain(points.map(function (d) { + return d.x; + })).rangeRoundBands([ + 0, + width + ]); + var y = d3.scale.linear().range([ + height, + 10 + ]); + var xAxis = d3.svg.axis().scale(x).orient('bottom'); + filterXAxis(xAxis, x); + var yAxis = d3.svg.axis().scale(y).orient('left').ticks(5).tickFormat(d3.format(config.yAxisTickFormat)); + var line = d3.svg.line().interpolate(config.lineCurveType).x(function (d) { + return getX(d.x); + }).y(function (d) { + return y(d.y); + }); + var yData = [0]; + var linedata = []; + points.forEach(function (d) { + d.y.map(function (e) { + yData.push(e); + }); }); - }); - - var yMaxPoints = d3.max(points.map(function(d) { - return d.y.length; - })); - scope.yMaxData = yMaxPoints; - series.slice(0, yMaxPoints).forEach(function(value, index) { - var d = {}; - d.series = value; - d.values = points.map(function(point) { - return point.y.map(function(e) { - return { - x: point.x, - y: e, - tooltip: point.tooltip + var yMaxPoints = d3.max(points.map(function (d) { + return d.y.length; + })); + scope.yMaxData = yMaxPoints; + series.slice(0, yMaxPoints).forEach(function (value, index) { + var d = {}; + d.series = value; + d.values = points.map(function (point) { + return point.y.map(function (e) { + return { + x: point.x, + y: e, + tooltip: point.tooltip + }; + })[index] || { + x: points[index].x, + y: 0 }; - })[index] || { - x: points[index].x, - y: 0 - }; + }); + linedata.push(d); }); - linedata.push(d); - }); - - var svg = d3.select(chartContainer[0]).append("svg") - .attr("width", width + margin.left + margin.right) - .attr("height", height + margin.top + margin.bottom) - .append("g") - .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); - - var padding = d3.max(yData) * 0.20; - - y.domain([d3.min(yData), d3.max(yData) + padding]); - - svg.append("g") - .attr("class", "x axis") - .attr("transform", "translate(0," + height + ")") - .call(xAxis); - - svg.append("g") - .attr("class", "y axis") - .call(yAxis); - - var point = svg.selectAll(".points") - .data(linedata) - .enter().append("g"); - - var path = point.attr("points", "points") - .append("path") - .attr("class", "ac-line") - .style("stroke", function(d, i) { - return getColor(i); - }) - .attr("d", function(d) { - return line(d.values); - }) - .attr("stroke-width", "2") - .attr("fill", "none"); - - /** Animation function + var svg = d3.select(chartContainer[0]).append('svg').attr('width', width + margin.left + margin.right).attr('height', height + margin.top + margin.bottom).append('g').attr('transform', 'translate(' + margin.left + ',' + margin.top + ')'); + var padding = d3.max(yData) * 0.2; + y.domain([ + d3.min(yData), + d3.max(yData) + padding + ]); + if (config.xAxisRotateLabels.rotate) { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); + } else { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); + } + svg.append('g').attr('class', 'y axis').call(yAxis); + var point = svg.selectAll('.points').data(linedata).enter().append('g'); + var path = point.attr('points', 'points').append('path').attr('class', 'ac-line').style('stroke', function (d, i) { + return getColor(i); + }).attr('d', function (d) { + return line(d.values); + }).attr('stroke-width', '2').attr('fill', 'none'); + /** Animation function * [last description] * @type {[type]} */ - if (linedata.length > 0) { - var last = linedata[linedata.length - 1].values; - if (last.length > 0) { - var totalLength = path.node().getTotalLength() + getX(last[last.length - 1].x); - - path.attr("stroke-dasharray", totalLength + " " + totalLength) - .attr("stroke-dashoffset", totalLength) - .transition() - .duration(config.isAnimate ? 1500 : 0) - .ease("linear") - .attr("stroke-dashoffset", 0) - .attr("d", function(d) { + if (linedata.length > 0) { + var last = linedata[linedata.length - 1].values; + if (last.length > 0) { + var totalLength = path.node().getTotalLength() + getX(last[last.length - 1].x); + path.attr('stroke-dasharray', totalLength + ' ' + totalLength).attr('stroke-dashoffset', totalLength).transition().duration(config.isAnimate ? 1500 : 0).ease('linear').attr('stroke-dashoffset', 0).attr('d', function (d) { return line(d.values); }); + } } - } - - /** + /** * Add points * @param {[type]} value [description] * @param {[type]} key [description] * @return {[type]} [description] */ - angular.forEach(linedata, function(value, key) { - var points = svg.selectAll('.circle') - .data(value.values) - .enter(); - - points.append("circle") - .attr("cx", function(d) { + angular.forEach(linedata, function (value, key) { + var points = svg.selectAll('.circle').data(value.values).enter(); + points.append('circle').attr('cx', function (d) { return getX(d.x); - }) - .attr("cy", function(d) { + }).attr('cy', function (d) { return y(d.y); - }) - .attr("r", 3) - .style("fill", getColor(linedata.indexOf(value))) - .style("stroke", getColor(linedata.indexOf(value))) - .on("mouseover", (function(series) { - return function(d) { - + }).attr('r', 3).style('fill', getColor(linedata.indexOf(value))).style('stroke', getColor(linedata.indexOf(value))).on('mouseover', function (series) { + return function (d) { makeToolTip({ index: d.x, value: d.tooltip ? d.tooltip : d.y, series: series }, d3.event); - config.mouseover(d, d3.event); scope.$apply(); }; - })(value.series)) - .on("mouseleave", function(d) { + }(value.series)).on('mouseleave', function (d) { removeToolTip(); config.mouseout(d, d3.event); scope.$apply(); - }) - .on("mousemove", function(d) { + }).on('mousemove', function (d) { updateToolTip(d, d3.event); - }) - .on("click", function(d) { + }).on('click', function (d) { config.click(d, d3.event); scope.$apply(); }); - - if (config.labels) { - points.append("text") - .attr("x", function(d) { + if (config.labels) { + points.append('text').attr('x', function (d) { return getX(d.x); - }) - .attr("y", function(d) { + }).attr('y', function (d) { return y(d.y); - }) - .text(function(d) { + }).text(function (d) { return d.y; }); - } - }); - - - /** + } + }); + /** * Labels at the end of line */ - if (config.lineLegend === 'lineEnd') { - point.append("text") - .datum(function(d) { + if (config.lineLegend === 'lineEnd') { + point.append('text').datum(function (d) { return { name: d.series, value: d.values[d.values.length - 1] }; - }) - .attr("transform", function(d) { - return "translate(" + getX(d.value.x) + "," + y(d.value.y) + ")"; - }) - .attr("x", 3) - .text(function(d) { + }).attr('transform', function (d) { + return 'translate(' + getX(d.value.x) + ',' + y(d.value.y) + ')'; + }).attr('x', 3).text(function (d) { return d.name; }); - } - - /** + } + /** * Returns x point of line point * @param {[type]} d [description] * @return {[type]} [description] */ - function getX(d) { - return Math.round(x(d)) + x.rangeBand() / 2; + function getX(d) { + return Math.round(x(d)) + x.rangeBand() / 2; + } + return linedata; } - - return linedata; - } - - - /** + /** * Creates a nice area chart * @return {[type]} [description] */ - function areaChart() { - var margin = { - top: 0, - right: 40, - bottom: 20, - left: 40 - }; - width -= margin.left + margin.right; - height -= margin.top + margin.bottom; - - var x = d3.scale.ordinal() - .domain(points.map(function(d) { - return d.x; - })) - .rangePoints([0, width]); - - var y = d3.scale.linear() - .range([height, 10]); - - var xAxis = d3.svg.axis() - .scale(x) - .orient("bottom"); - filterXAxis(xAxis, x); - - var yAxis = d3.svg.axis() - .scale(y) - .orient("left") - .ticks(5) - .tickFormat(d3.format(config.yAxisTickFormat)); - - d3.svg.line() - .interpolate(config.lineCurveType) - .x(function(d) { + function areaChart() { + var margin = { + top: 0, + right: 40, + bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + left: 40 + }; + width -= margin.left + margin.right; + height -= margin.top + margin.bottom; + var x = d3.scale.ordinal().domain(points.map(function (d) { + return d.x; + })).rangePoints([ + 0, + width + ]); + var y = d3.scale.linear().range([ + height, + 10 + ]); + var xAxis = d3.svg.axis().scale(x).orient('bottom'); + filterXAxis(xAxis, x); + var yAxis = d3.svg.axis().scale(y).orient('left').ticks(5).tickFormat(d3.format(config.yAxisTickFormat)); + d3.svg.line().interpolate(config.lineCurveType).x(function (d) { return getX(d.x); - }) - .y(function(d) { + }).y(function (d) { return y(d.y); }); - - var yData = [0]; - var linedata = []; - - points.forEach(function(d) { - d.y.map(function(e) { - yData.push(e); + var yData = [0]; + var linedata = []; + points.forEach(function (d) { + d.y.map(function (e) { + yData.push(e); + }); }); - }); - - var yMaxPoints = d3.max(points.map(function(d) { - return d.y.length; - })); - - /** + var yMaxPoints = d3.max(points.map(function (d) { + return d.y.length; + })); + /** * Important to set for legend * @type {[type]} */ - scope.yMaxData = yMaxPoints; - - series.slice(0, yMaxPoints).forEach(function(value, index) { - var d = {}; - d.series = value; - d.values = points.map(function(point) { - return point.y.map(function(e) { - return { - x: point.x, - y: e + scope.yMaxData = yMaxPoints; + series.slice(0, yMaxPoints).forEach(function (value, index) { + var d = {}; + d.series = value; + d.values = points.map(function (point) { + return point.y.map(function (e) { + return { + x: point.x, + y: e + }; + })[index] || { + x: points[index].x, + y: 0 }; - })[index] || { - x: points[index].x, - y: 0 - }; - }); - linedata.push(d); - }); - - var svg = d3.select(chartContainer[0]).append("svg") - .attr("width", width + margin.left + margin.right) - .attr("height", height + margin.top + margin.bottom) - .append("g") - .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); - - var padding = d3.max(yData) * 0.20; - - y.domain([d3.min(yData), d3.max(yData) + padding]); - - svg.append("g") - .attr("class", "x axis") - .attr("transform", "translate(0," + height + ")") - .call(xAxis); - - svg.append("g") - .attr("class", "y axis") - .call(yAxis); - - var point = svg.selectAll(".points") - .data(linedata) - .enter().append("g"); - - var area = d3.svg.area() - .interpolate('basis') - .x(function(d) { - return getX(d.x); - }) - .y0(function() { - return y(0); - }) - .y1(function(d) { - return y(0 + d.y); + }); + linedata.push(d); }); - - point.append("path") - .attr("class", "area") - .attr("d", function(d) { + var svg = d3.select(chartContainer[0]).append('svg').attr('width', width + margin.left + margin.right).attr('height', height + margin.top + margin.bottom).append('g').attr('transform', 'translate(' + margin.left + ',' + margin.top + ')'); + var padding = d3.max(yData) * 0.2; + y.domain([ + d3.min(yData), + d3.max(yData) + padding + ]); + if (config.xAxisRotateLabels.rotate) { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); + } else { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); + } + svg.append('g').attr('class', 'y axis').call(yAxis); + var point = svg.selectAll('.points').data(linedata).enter().append('g'); + var area = d3.svg.area().interpolate('basis').x(function (d) { + return getX(d.x); + }).y0(function () { + return y(0); + }).y1(function (d) { + return y(0 + d.y); + }); + point.append('path').attr('class', 'area').attr('d', function (d) { return area(d.values); - }) - .style("fill", function(d, i) { + }).style('fill', function (d, i) { return getColor(i); - }) - .style("opacity", "0.7"); - - function getX(d) { - return Math.round(x(d)) + x.rangeBand() / 2; + }).style('opacity', '0.7'); + function getX(d) { + return Math.round(x(d)) + x.rangeBand() / 2; + } } - } - - /** + /** * Draws a beautiful pie chart * @return {[type]} [description] */ - function pieChart() { - var radius = Math.min(width, height) / 2; - var svg = d3.select(chartContainer[0]).append("svg") - .attr("width", width) - .attr("height", height) - .append("g") - .attr("transform", "translate(" + width / 2 + "," + height / 2 + ")"); - var innerRadius = 0; - - if (config.innerRadius) { - var configRadius = config.innerRadius; - if (typeof(configRadius) === 'string' && configRadius.indexOf('%') > 0) { - configRadius = radius * (parseFloat(configRadius) * 0.01); - } else { - configRadius = Number(configRadius); - } - - if (configRadius >= 0) { - innerRadius = configRadius; + function pieChart() { + var radius = Math.min(width, height) / 2; + var svg = d3.select(chartContainer[0]).append('svg').attr('width', width).attr('height', height).append('g').attr('transform', 'translate(' + width / 2 + ',' + height / 2 + ')'); + var innerRadius = 0; + if (config.innerRadius) { + var configRadius = config.innerRadius; + if (typeof configRadius === 'string' && configRadius.indexOf('%') > 0) { + configRadius = radius * (parseFloat(configRadius) * 0.01); + } else { + configRadius = Number(configRadius); + } + if (configRadius >= 0) { + innerRadius = configRadius; + } } - } - - scope.yMaxData = points.length; - - var arc = d3.svg.arc() - .outerRadius(radius - 10) - .innerRadius(innerRadius); - - d3.svg.arc() - .outerRadius(radius + 5) - .innerRadius(0); - - var pie = d3.layout.pie() - .sort(null) - .value(function(d) { - return d.y[0]; - }); - - var path = svg.selectAll(".arc") - .data(pie(points)) - .enter().append("g"); - - var complete = false; - - path.append("path") - .style("fill", function(d, i) { + scope.yMaxData = points.length; + var arc = d3.svg.arc().outerRadius(radius - 10).innerRadius(innerRadius); + d3.svg.arc().outerRadius(radius + 5).innerRadius(0); + var pie = d3.layout.pie().sort(null).value(function (d) { + return d.y[0]; + }); + var path = svg.selectAll('.arc').data(pie(points)).enter().append('g'); + var complete = false; + path.append('path').style('fill', function (d, i) { return getColor(i); - }) - .transition() - .ease("linear") - .duration(config.isAnimate ? 500 : 0) - .attrTween("d", tweenPie) - .attr("class", "arc") - .each('end', function() { + }).transition().ease('linear').duration(config.isAnimate ? 500 : 0).attrTween('d', tweenPie).attr('class', 'arc').each('end', function () { //avoid firing multiple times if (!complete) { complete = true; - //Add listeners when transition is done - path.on("mouseover", function(d) { - makeToolTip({ - value: d.data.tooltip ? d.data.tooltip : d.data.y[0] - }, d3.event); - d3.select(this) - .select('path') - .transition() - .duration(200) - .style("stroke", "white") - .style("stroke-width", "2px"); + path.on('mouseover', function (d) { + makeToolTip({ value: d.data.tooltip ? d.data.tooltip : d.data.y[0] }, d3.event); + d3.select(this).select('path').transition().duration(200).style('stroke', 'white').style('stroke-width', '2px'); config.mouseover(d, d3.event); scope.$apply(); - }) - .on("mouseleave", function(d) { - d3.select(this) - .select('path') - .transition() - .duration(200) - .style("stroke", "") - .style("stroke-width", ""); - removeToolTip(); - config.mouseout(d, d3.event); - scope.$apply(); - }) - .on("mousemove", function(d) { - updateToolTip(d, d3.event); - }) - .on("click", function(d) { - config.click(d, d3.event); - scope.$apply(); - }); - + }).on('mouseleave', function (d) { + d3.select(this).select('path').transition().duration(200).style('stroke', '').style('stroke-width', ''); + removeToolTip(); + config.mouseout(d, d3.event); + scope.$apply(); + }).on('mousemove', function (d) { + updateToolTip(d, d3.event); + }).on('click', function (d) { + config.click(d, d3.event); + scope.$apply(); + }); } }); - - if (!!config.labels) { - path.append("text") - .attr("transform", function(d) { - return "translate(" + arc.centroid(d) + ")"; - }) - .attr("dy", ".35em") - .style("text-anchor", "middle") - .text(function(d) { + if (!!config.labels) { + path.append('text').attr('transform', function (d) { + return 'translate(' + arc.centroid(d) + ')'; + }).attr('dy', '.35em').style('text-anchor', 'middle').text(function (d) { return d.data.y[0]; }); + } + function tweenPie(b) { + b.innerRadius = 0; + var i = d3.interpolate({ + startAngle: 0, + endAngle: 0 + }, b); + return function (t) { + return arc(i(t)); + }; + } } - - function tweenPie(b) { - b.innerRadius = 0; - var i = d3.interpolate({ - startAngle: 0, - endAngle: 0 - }, b); - return function(t) { - return arc(i(t)); - }; - } - } - - - function pointChart() { - var margin = { - top: 0, - right: 40, - bottom: 20, - left: 40 - }; - width -= margin.left - margin.right; - height -= margin.top - margin.bottom; - - var x = d3.scale.ordinal() - .domain(points.map(function(d) { - return d.x; - })) - .rangeRoundBands([0, width]); - - var y = d3.scale.linear() - .range([height, 10]); - - var xAxis = d3.svg.axis() - .scale(x) - .orient("bottom"); - filterXAxis(xAxis, x); - - var yAxis = d3.svg.axis() - .scale(y) - .orient("left") - .ticks(5) - .tickFormat(d3.format(config.yAxisTickFormat)); - - var yData = [0]; - var linedata = []; - - points.forEach(function(d) { - d.y.map(function(e, i) { - yData.push(e); + function pointChart() { + var margin = { + top: 0, + right: 40, + bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + left: 40 + }; + width -= margin.left - margin.right; + height -= margin.top - margin.bottom; + var x = d3.scale.ordinal().domain(points.map(function (d) { + return d.x; + })).rangeRoundBands([ + 0, + width + ]); + var y = d3.scale.linear().range([ + height, + 10 + ]); + var xAxis = d3.svg.axis().scale(x).orient('bottom'); + filterXAxis(xAxis, x); + var yAxis = d3.svg.axis().scale(y).orient('left').ticks(5).tickFormat(d3.format(config.yAxisTickFormat)); + var yData = [0]; + var linedata = []; + points.forEach(function (d) { + d.y.map(function (e, i) { + yData.push(e); + }); }); - }); - - var yMaxPoints = d3.max(points.map(function(d) { - return d.y.length; - })); - scope.yMaxPoints = yMaxPoints; - - series.slice(0, yMaxPoints).forEach(function(value, index) { - var d = {}; - d.series = value; - d.values = points.map(function(point) { - return point.y.map(function(e) { - return { - x: point.x, - y: e + var yMaxPoints = d3.max(points.map(function (d) { + return d.y.length; + })); + scope.yMaxPoints = yMaxPoints; + series.slice(0, yMaxPoints).forEach(function (value, index) { + var d = {}; + d.series = value; + d.values = points.map(function (point) { + return point.y.map(function (e) { + return { + x: point.x, + y: e + }; + })[index] || { + x: points[index].x, + y: 0 }; - })[index] || { - x: points[index].x, - y: 0 - }; + }); + linedata.push(d); }); - linedata.push(d); - }); - - var svg = d3.select(chartContainer[0]).append("svg") - .attr("width", width + margin.left + margin.right) - .attr("height", height + margin.top + margin.bottom) - .append("g") - .attr("transform", "translate(" + margin.left + "," + margin.top + ")"); - - var padding = d3.max(yData) * 0.20; - - y.domain([d3.min(yData), d3.max(yData) + padding]); - - svg.append("g") - .attr("class", "x axis") - .attr("transform", "translate(0," + height + ")") - .call(xAxis); - - svg.append("g") - .attr("class", "y axis") - .call(yAxis); - - svg.selectAll(".points") - .data(linedata) - .enter().append("g"); - - /** + var svg = d3.select(chartContainer[0]).append('svg').attr('width', width + margin.left + margin.right).attr('height', height + margin.top + margin.bottom).append('g').attr('transform', 'translate(' + margin.left + ',' + margin.top + ')'); + var padding = d3.max(yData) * 0.2; + y.domain([ + d3.min(yData), + d3.max(yData) + padding + ]); + if (config.xAxisRotateLabels.rotate) { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); + } else { + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); + } + svg.append('g').attr('class', 'y axis').call(yAxis); + svg.selectAll('.points').data(linedata).enter().append('g'); + /** * Add points * @param {[type]} value [description] * @param {[type]} key [description] * @return {[type]} [description] */ - angular.forEach(linedata, function(value, key) { - var points = svg.selectAll('.circle') - .data(value.values) - .enter(); - - points.append("circle") - .attr("cx", function(d) { + angular.forEach(linedata, function (value, key) { + var points = svg.selectAll('.circle').data(value.values).enter(); + points.append('circle').attr('cx', function (d) { return getX(d.x); - }) - .attr("cy", function(d) { + }).attr('cy', function (d) { return y(d.y); - }) - .attr("r", 3) - .style("fill", getColor(linedata.indexOf(value))) - .style("stroke", getColor(linedata.indexOf(value))) - .on("mouseover", (function(series) { - return function(d) { - + }).attr('r', 3).style('fill', getColor(linedata.indexOf(value))).style('stroke', getColor(linedata.indexOf(value))).on('mouseover', function (series) { + return function (d) { makeToolTip({ index: d.x, value: d.tooltip ? d.tooltip : d.y, series: series }, d3.event); - config.mouseover(d, d3.event); scope.$apply(); }; - })(value.series)) - .on("mouseleave", function(d) { + }(value.series)).on('mouseleave', function (d) { removeToolTip(); config.mouseout(d, d3.event); scope.$apply(); - }) - .on("mousemove", function(d) { + }).on('mousemove', function (d) { updateToolTip(d3.event); - }) - .on("click", function(d) { + }).on('click', function (d) { config.click(d, d3.event); scope.$apply(); }); - - if (config.labels) { - points.append("text") - .attr("x", function(d) { + if (config.labels) { + points.append('text').attr('x', function (d) { return getX(d.x); - }) - .attr("y", function(d) { + }).attr('y', function (d) { return y(d.y); - }) - .text(function(d) { + }).text(function (d) { return d.y; }); - } - }); - - /** + } + }); + /** * Returns x point of line point * @param {[type]} d [description] * @return {[type]} [description] */ - function getX(d) { - return Math.round(x(d)) + x.rangeBand() / 2; + function getX(d) { + return Math.round(x(d)) + x.rangeBand() / 2; + } } - } - - /** + /** * Creates and displays tooltip * @return {[type]} [description] */ - function makeToolTip(data, event) { - if (!config.tooltips) { - return; - } - if (typeof config.tooltips === 'function') { - data = config.tooltips(data); - } else { - data = data.value; + function makeToolTip(data, event) { + if (!config.tooltips) { + return; + } + if (typeof config.tooltips === 'function') { + data = config.tooltips(data); + } else { + data = data.value; + } + var el = angular.element('

').html(data).css({ + left: event.pageX + 20 + 'px', + top: event.pageY - 30 + 'px' + }); + angular.element(document.querySelector('.ac-tooltip')).remove(); + angular.element(document.body).append(el); + scope.$tooltip = el; } - - var el = angular.element('

') - .html(data) - .css({ - left: (event.pageX + 20) + 'px', - top: (event.pageY - 30) + 'px' - }); - - angular.element(document.querySelector('.ac-tooltip')).remove(); - angular.element(document.body).append(el); - - scope.$tooltip = el; - } - - /** + /** * Clears the tooltip from body * @return {[type]} [description] */ - function removeToolTip() { - if (scope.$tooltip) { - scope.$tooltip.remove(); + function removeToolTip() { + if (scope.$tooltip) { + scope.$tooltip.remove(); + } } - } - - function updateToolTip(d, event) { - if (scope.$tooltip) { - scope.$tooltip.css({ - left: (event.pageX + 20) + 'px', - top: (event.pageY - 30) + 'px' - }); + function updateToolTip(d, event) { + if (scope.$tooltip) { + scope.$tooltip.css({ + left: event.pageX + 20 + 'px', + top: event.pageY - 30 + 'px' + }); + } } - } - - /** + /** * Adds data to legend * @return {[type]} [description] */ - function drawLegend() { - scope.legends = []; - if (chartType === 'pie') { - angular.forEach(points, function(value, key) { - scope.legends.push({ - color: config.colors[key], - title: getBindableTextForLegend(value.x) + function drawLegend() { + scope.legends = []; + if (chartType === 'pie') { + angular.forEach(points, function (value, key) { + scope.legends.push({ + color: config.colors[key], + title: getBindableTextForLegend(value.x) + }); }); - }); - } - if (chartType === 'bar' || chartType === 'area' || chartType === 'point' || - (chartType === 'line' && config.lineLegend === 'traditional')) { - angular.forEach(series, function(value, key) { - scope.legends.push({ - color: config.colors[key], - title: getBindableTextForLegend(value) + } + if (chartType === 'bar' || chartType === 'area' || chartType === 'point' || chartType === 'line' && config.lineLegend === 'traditional') { + angular.forEach(series, function (value, key) { + scope.legends.push({ + color: config.colors[key], + title: getBindableTextForLegend(value) + }); }); + } + } + var HTML_ENTITY_MAP = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + '\'': ''', + '/': '/' + }; + function escapeHtml(string) { + return String(string).replace(/[&<>"'\/]/g, function (char) { + return HTML_ENTITY_MAP[char]; }); } - } - - var HTML_ENTITY_MAP = { - "&": "&", - "<": "<", - ">": ">", - '"': '"', - "'": ''', - "/": '/' - }; - - function escapeHtml(string) { - return String(string).replace(/[&<>"'\/]/g, function(char) { - return HTML_ENTITY_MAP[char]; - }); - } - - function getBindableTextForLegend(text) { - return $sce.trustAsHtml(config.legend.htmlEnabled ? text : escapeHtml(text)); - } - - /** + function getBindableTextForLegend(text) { + return $sce.trustAsHtml(config.legend.htmlEnabled ? text : escapeHtml(text)); + } + /** * Checks if index is available in color * else returns a random color * @param {[type]} i [description] * @return {[type]} [description] */ - function getColor(i) { - if (i < config.colors.length) { - return config.colors[i]; - } else { - var color = getRandomColor(); - config.colors.push(color); - return color; + function getColor(i) { + if (i < config.colors.length) { + return config.colors[i]; + } else { + var color = getRandomColor(); + config.colors.push(color); + return color; + } } - } - - var w = angular.element($window); - var resizePromise = null; - w.bind('resize', function(ev) { - resizePromise && $timeout.cancel(resizePromise); - resizePromise = $timeout(function() { - totalWidth = element[0].clientWidth; - totalHeight = element[0].clientHeight; - init(); - }, 100); - }); - - scope.getWindowDimensions = function() { - return { - 'h': w[0].clientHeight, - 'w': w[0].clientWidth + var w = angular.element($window); + var resizePromise = null; + w.bind('resize', function (ev) { + resizePromise && $timeout.cancel(resizePromise); + resizePromise = $timeout(function () { + totalWidth = element[0].clientWidth; + totalHeight = element[0].clientHeight; + init(); + }, 100); + }); + scope.getWindowDimensions = function () { + return { + 'h': w[0].clientHeight, + 'w': w[0].clientWidth + }; }; - }; - - // Watch for any of the config changing. - scope.$watch('[acChart, acData, acConfig]', init, true); - - scope.$watch(function() { + // Watch for any of the config changing. + scope.$watch('[acChart, acData, acConfig]', init, true); + scope.$watch(function () { return { w: element[0].clientWidth, - h: element[0].clientHeight + h: element[0].clientHeight, }; - }, - function(newvalue) { + }, function (newvalue) { totalWidth = newvalue.w; totalHeight = newvalue.h; + init(); }, true); - } + } - return { - restrict: 'EA', - link: link, - transclude: 'true', - scope: { - acChart: '=', - acData: '=', - acConfig: '=' + return { + restrict: 'EA', + link: link, + transclude: 'true', + scope: { + acChart: '=', + acData: '=', + acConfig: '=' + } + }; + } +]); +(function () { + // styles.min.css + var cssText = "" + +".angular-charts-template .axis path,.angular-charts-template .axis line{fill:none;stroke:#333}.angular-charts-template .ac-title{font-weight:700;font-size:1.2em}.angular-charts-template .ac-chart{float:left;width:75%}.angular-charts-template .ac-line{fill:none;stroke-width:2px}.angular-charts-template table{float:left;max-width:25%;list-style:none;margin:0;padding:0}.angular-charts-template td[ng-bind]{display:inline-block}.angular-charts-template .ac-legend-box{border-radius:5px;height:15px;width:15px}.ac-tooltip{display:block;position:absolute;border:2px solid rgba(51,51,51,.9);background-color:rgba(22,22,22,.7);border-radius:5px;padding:5px;color:#fff}"; + // cssText end + + var styleEl = document.createElement("style"); + document.getElementsByTagName("head")[0].appendChild(styleEl); + if (styleEl.styleSheet) { + if (!styleEl.styleSheet.disabled) { + styleEl.styleSheet.cssText = cssText; + } + } else { + try { + styleEl.innerHTML = cssText + } catch(e) { + styleEl.innerText = cssText; + } } - }; -}); +}()); + +angular.module('angularChartsTemplates', ['angularChartsTemplate_left', 'angularChartsTemplate_right']); + +angular.module("angularChartsTemplate_left", []).run(["$templateCache", function($templateCache) { + $templateCache.put("angularChartsTemplate_left", + "
{{acConfig.title}}
"); +}]); + +angular.module("angularChartsTemplate_right", []).run(["$templateCache", function($templateCache) { + $templateCache.put("angularChartsTemplate_right", + "
{{acConfig.title}}
"); +}]); From 175a3e94cde912d62b8f7c4836b4bbcd80020ca6 Mon Sep 17 00:00:00 2001 From: Michael Kelley Date: Tue, 22 Dec 2015 00:49:01 -0500 Subject: [PATCH 2/3] fixed prepareConfig() location to properly detect changes to scope's config objects --- src/angular-charts.js | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/angular-charts.js b/src/angular-charts.js index 34d97e2..5987120 100644 --- a/src/angular-charts.js +++ b/src/angular-charts.js @@ -105,7 +105,7 @@ angular.module('angularCharts').directive('acChart', [ extendBottom: 0 // number of px, if any to extend bottom margin to accomodate rotated labels } }; - prepareConfig(); + var totalWidth = element[0].clientWidth; var totalHeight = element[0].clientHeight; validateHeightAndWidth(); @@ -119,10 +119,10 @@ angular.module('angularCharts').directive('acChart', [ * @return {[type]} [description] */ function init() { + prepareConfig(); if (!validateHeightAndWidth()) { return; } - prepareConfig(); prepareData(); setHeightWidth(); setContainers(); From b01523dfdac8e4be145167a8975dcc758dcf6617 Mon Sep 17 00:00:00 2001 From: Michael Kelley Date: Wed, 23 Dec 2015 18:56:02 -0500 Subject: [PATCH 3/3] scope watch issues --- src/angular-charts.js | 52 +++++++++++++------------------------------ 1 file changed, 15 insertions(+), 37 deletions(-) diff --git a/src/angular-charts.js b/src/angular-charts.js index 5987120..ad3f6e8 100644 --- a/src/angular-charts.js +++ b/src/angular-charts.js @@ -98,14 +98,9 @@ angular.module('angularCharts').directive('acChart', [ lineCurveType: 'cardinal', isAnimate: true, yAxisTickFormat: 's', - waitForHeightAndWidth: false, - xAxisRotateLabels: { - rotate: false, // boolean, default to false. true rotates x-axis labels by n degrees - degrees: 0,// number of degrees to rotate x-axis label - extendBottom: 0 // number of px, if any to extend bottom margin to accomodate rotated labels - } + waitForHeightAndWidth: false }; - + prepareConfig(); var totalWidth = element[0].clientWidth; var totalHeight = element[0].clientHeight; validateHeightAndWidth(); @@ -123,6 +118,7 @@ angular.module('angularCharts').directive('acChart', [ if (!validateHeightAndWidth()) { return; } + prepareData(); setHeightWidth(); setContainers(); @@ -170,6 +166,7 @@ angular.module('angularCharts').directive('acChart', [ * Creates appropriate DOM structure for legend + chart */ function setContainers() { + //prepareConfig(); var container = $templateCache.get('angularChartsTemplate_' + config.legend.position); element.html(container); //http://stackoverflow.com/a/17883151 @@ -237,7 +234,7 @@ angular.module('angularCharts').directive('acChart', [ var margin = { top: 0, right: 20, - bottom: 30 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + bottom: 150, left: 40 }; width -= margin.left + margin.right; @@ -294,11 +291,7 @@ angular.module('angularCharts').directive('acChart', [ * @type {[type]} */ var svg = d3.select(chartContainer[0]).append('svg').attr('width', width + margin.left + margin.right).attr('height', height + margin.top + margin.bottom).append('g').attr('transform', 'translate(' + margin.left + ',' + margin.top + ')'); - if (config.xAxisRotateLabels.rotate) { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); - } else { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); - } + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(90)').style('text-anchor', 'start'); svg.append('g').attr('class', 'y axis').call(yAxis); /** * Add bars @@ -370,7 +363,7 @@ angular.module('angularCharts').directive('acChart', [ var margin = { top: 0, right: 40, - bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + bottom: 20, left: 40 }; width -= margin.left + margin.right; @@ -427,11 +420,7 @@ angular.module('angularCharts').directive('acChart', [ d3.min(yData), d3.max(yData) + padding ]); - if (config.xAxisRotateLabels.rotate) { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); - } else { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); - } + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); svg.append('g').attr('class', 'y axis').call(yAxis); var point = svg.selectAll('.points').data(linedata).enter().append('g'); var path = point.attr('points', 'points').append('path').attr('class', 'ac-line').style('stroke', function (d, i) { @@ -527,7 +516,7 @@ angular.module('angularCharts').directive('acChart', [ var margin = { top: 0, right: 40, - bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + bottom: 20, left: 40 }; width -= margin.left + margin.right; @@ -587,11 +576,7 @@ angular.module('angularCharts').directive('acChart', [ d3.min(yData), d3.max(yData) + padding ]); - if (config.xAxisRotateLabels.rotate) { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); - } else { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); - } + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); svg.append('g').attr('class', 'y axis').call(yAxis); var point = svg.selectAll('.points').data(linedata).enter().append('g'); var area = d3.svg.area().interpolate('basis').x(function (d) { @@ -684,7 +669,7 @@ angular.module('angularCharts').directive('acChart', [ var margin = { top: 0, right: 40, - bottom: 20 + (config.xAxisRotateLabels.rotate ? config.xAxisRotateLabels.extendBottom : 0), + bottom: 20, left: 40 }; width -= margin.left - margin.right; @@ -735,11 +720,7 @@ angular.module('angularCharts').directive('acChart', [ d3.min(yData), d3.max(yData) + padding ]); - if (config.xAxisRotateLabels.rotate) { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis).selectAll('text').attr('y', 0).attr('x', 9).attr('dy', '.35em').attr('transform', 'rotate(' + config.xAxisRotateLabels.degrees + ')').style('text-anchor', 'start'); - } else { - svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); - } + svg.append('g').attr('class', 'x axis').attr('transform', 'translate(0,' + height + ')').call(xAxis); svg.append('g').attr('class', 'y axis').call(yAxis); svg.selectAll('.points').data(linedata).enter().append('g'); /** @@ -906,16 +887,14 @@ angular.module('angularCharts').directive('acChart', [ scope.$watch(function () { return { w: element[0].clientWidth, - h: element[0].clientHeight, + h: element[0].clientHeight }; }, function (newvalue) { totalWidth = newvalue.w; totalHeight = newvalue.h; - init(); }, true); } - return { restrict: 'EA', link: link, @@ -930,8 +909,7 @@ angular.module('angularCharts').directive('acChart', [ ]); (function () { // styles.min.css - var cssText = "" + -".angular-charts-template .axis path,.angular-charts-template .axis line{fill:none;stroke:#333}.angular-charts-template .ac-title{font-weight:700;font-size:1.2em}.angular-charts-template .ac-chart{float:left;width:75%}.angular-charts-template .ac-line{fill:none;stroke-width:2px}.angular-charts-template table{float:left;max-width:25%;list-style:none;margin:0;padding:0}.angular-charts-template td[ng-bind]{display:inline-block}.angular-charts-template .ac-legend-box{border-radius:5px;height:15px;width:15px}.ac-tooltip{display:block;position:absolute;border:2px solid rgba(51,51,51,.9);background-color:rgba(22,22,22,.7);border-radius:5px;padding:5px;color:#fff}"; + var cssText = ".angular-charts-template .axis path,.angular-charts-template .axis line{fill:none;stroke:#333}.angular-charts-template .ac-title{font-weight:700;font-size:1.2em}.angular-charts-template .ac-chart{float:left;width:75%}.angular-charts-template .ac-line{fill:none;stroke-width:2px}.angular-charts-template table{float:left;max-width:25%;list-style:none;margin:0;padding:0}.angular-charts-template td[ng-bind]{display:inline-block}.angular-charts-template .ac-legend-box{border-radius:5px;height:15px;width:15px}.ac-tooltip{display:block;position:absolute;border:2px solid rgba(51,51,51,.9);background-color:rgba(22,22,22,.7);border-radius:5px;padding:5px;color:#fff}"; // cssText end var styleEl = document.createElement("style"); @@ -942,7 +920,7 @@ angular.module('angularCharts').directive('acChart', [ } } else { try { - styleEl.innerHTML = cssText + styleEl.innerHTML = cssText; } catch(e) { styleEl.innerText = cssText; }